About 2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one
2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one (PubChem CID 10221189) has the molecular formula C17H26N2O
and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one.
Molecular Properties
| Compound Name | 2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one |
| PubChem CID | 10221189 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one |
| SMILES | CCCCCCN1CCN(c2cccccc2=O)CC1 |
| InChI | InChI=1S/C17H26N2O/c1-2-3-4-8-11-18-12-14-19(15-13-18)16-9-6-5-7-10-17(16)20/h5-7,9-10H,2-4,8,11-15H2,1H3 |
| InChIKey | KQZHBECFZNJZKP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one?
The IUPAC name of 2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one (CID 10221189) is 2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one.
What is the SMILES notation for 2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one?
The canonical SMILES for 2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one is CCCCCCN1CCN(c2cccccc2=O)CC1.
What is the InChIKey of 2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one?
The InChIKey is KQZHBECFZNJZKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O/c1-2-3-4-8-11-18-12-14-19(15-13-18)16-9-6-5-7-10-17(16)20/h5-7,9-10H,2-4,8,11-15H2,1H3.
What are the key properties of 2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one?
2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one has a molecular weight of 274.41 g/mol, XLogP of 2.75, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hexylpiperazin-1-yl)cyclohepta-2,4,6-trien-1-one is sourced from PubChem (CID 10221189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).