C14H11ClN2O2 — CID 10221194
6-[(4-chlorophenoxy)methyl]-1,2-benzoxazol-3-amine (PubChem CID 10221194) has the molecular formula C14H11ClN2O2 and a molecular weight of 274.71 g/mol. Its IUPAC name is 6-[(4-chlorophenoxy)methyl]-1,2-benzoxazol-3-amine.
| Compound Name | 6-[(4-chlorophenoxy)methyl]-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 10221194 |
| Molecular Formula | C14H11ClN2O2 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 6-[(4-chlorophenoxy)methyl]-1,2-benzoxazol-3-amine |
| SMILES | Nc1noc2cc(COc3ccc(Cl)cc3)ccc12 |
| InChI | InChI=1S/C14H11ClN2O2/c15-10-2-4-11(5-3-10)18-8-9-1-6-12-13(7-9)19-17-14(12)16/h1-7H,8H2,(H2,16,17) |
| InChIKey | XCNCDWRUYAQGQQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |