About (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate
(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate (PubChem CID 10221221) has the molecular formula C10H13FN2O6
and a molecular weight of 276.22 g/mol. Its IUPAC name is (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate.
Molecular Properties
| Compound Name | (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate |
| PubChem CID | 10221221 |
| Molecular Formula | C10H13FN2O6 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate |
| SMILES | COCCOCC(=O)OCn1c(=O)[nH]cc(F)c1=O |
| InChI | InChI=1S/C10H13FN2O6/c1-17-2-3-18-5-8(14)19-6-13-9(15)7(11)4-12-10(13)16/h4H,2-3,5-6H2,1H3,(H,12,16) |
| InChIKey | LSWNWMOHPPMYNI-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate?
The IUPAC name of (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate (CID 10221221) is (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate.
What is the SMILES notation for (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate?
The canonical SMILES for (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate is COCCOCC(=O)OCn1c(=O)[nH]cc(F)c1=O.
What is the InChIKey of (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate?
The InChIKey is LSWNWMOHPPMYNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FN2O6/c1-17-2-3-18-5-8(14)19-6-13-9(15)7(11)4-12-10(13)16/h4H,2-3,5-6H2,1H3,(H,12,16).
What are the key properties of (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate?
(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate has a molecular weight of 276.22 g/mol, XLogP of -1.16, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-(2-methoxyethoxy)acetate is sourced from PubChem (CID 10221221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).