About (1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane
(1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane (PubChem CID 102212512) has the molecular formula C7H9Cl
and a molecular weight of 128.60 g/mol. Its IUPAC name is (1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane.
Molecular Properties
| Compound Name | (1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane |
| PubChem CID | 102212512 |
| Molecular Formula | C7H9Cl |
| Molecular Weight | 128.60 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | (1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane |
| SMILES | Cl[C@@H]1C2CC3C1[C@@H]3C2 |
| InChI | InChI=1S/C7H9Cl/c8-7-3-1-4-5(2-3)6(4)7/h3-7H,1-2H2/t3?,4-,5?,6?,7-/m1/s1 |
| InChIKey | BUZGNAVALTYIOX-XFQYLJLSSA-N |
| XLogP | 1.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.60 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane?
The IUPAC name of (1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane (CID 102212512) is (1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane.
What is the SMILES notation for (1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane?
The canonical SMILES for (1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane is Cl[C@@H]1C2CC3C1[C@@H]3C2.
What is the InChIKey of (1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane?
The InChIKey is BUZGNAVALTYIOX-XFQYLJLSSA-N. The full InChI is InChI=1S/C7H9Cl/c8-7-3-1-4-5(2-3)6(4)7/h3-7H,1-2H2/t3?,4-,5?,6?,7-/m1/s1.
What are the key properties of (1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane?
(1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane has a molecular weight of 128.60 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,3R)-3-chlorotricyclo[2.2.1.02,6]heptane is sourced from PubChem (CID 102212512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).