C17H17N2O+ — CID 102212532
3-methyl-1-phenyl-5,6,7,8-tetrahydrochromeno[2,3-c]pyrazol-1-ium (PubChem CID 102212532) has the molecular formula C17H17N2O+ and a molecular weight of 265.34 g/mol. Its IUPAC name is 3-methyl-1-phenyl-5,6,7,8-tetrahydrochromeno[2,3-c]pyrazol-1-ium.
| Compound Name | 3-methyl-1-phenyl-5,6,7,8-tetrahydrochromeno[2,3-c]pyrazol-1-ium |
|---|---|
| PubChem CID | 102212532 |
| Molecular Formula | C17H17N2O+ |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-methyl-1-phenyl-5,6,7,8-tetrahydrochromeno[2,3-c]pyrazol-1-ium |
| SMILES | Cc1n[n+](-c2ccccc2)c2oc3c(cc1-2)CCCC3 |
| InChI | InChI=1S/C17H17N2O/c1-12-15-11-13-7-5-6-10-16(13)20-17(15)19(18-12)14-8-3-2-4-9-14/h2-4,8-9,11H,5-7,10H2,1H3/q+1 |
| InChIKey | VXDYPAJLZJKWEX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|