C17H17NO5S — CID 102212996
dimethyl 2-oxo-3-phenyl-5,7-dihydrocyclopenta[d]thiazine-6,6-dicarboxylate (PubChem CID 102212996) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is dimethyl 2-oxo-3-phenyl-5,7-dihydrocyclopenta[d]thiazine-6,6-dicarboxylate.
| Compound Name | dimethyl 2-oxo-3-phenyl-5,7-dihydrocyclopenta[d]thiazine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 102212996 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | dimethyl 2-oxo-3-phenyl-5,7-dihydrocyclopenta[d]thiazine-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=CN(c3ccccc3)S(=O)C=C2C1 |
| InChI | InChI=1S/C17H17NO5S/c1-22-15(19)17(16(20)23-2)8-12-10-18(14-6-4-3-5-7-14)24(21)11-13(12)9-17/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | XZGNXWOKJSDVEX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|