About [(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane
[(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane (PubChem CID 102213211) has the molecular formula C18H36Si
and a molecular weight of 280.57 g/mol. Its IUPAC name is [(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane.
Molecular Properties
| Compound Name | [(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane |
| PubChem CID | 102213211 |
| Molecular Formula | C18H36Si |
| Molecular Weight | 280.57 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | [(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane |
| SMILES | CC[Si](CC)(CC)C/C(C)=C(/C)CC1CCCCC1 |
| InChI | InChI=1S/C18H36Si/c1-6-19(7-2,8-3)15-17(5)16(4)14-18-12-10-9-11-13-18/h18H,6-15H2,1-5H3/b17-16- |
| InChIKey | LUNPWBVPZMQHBG-MSUUIHNZSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.57 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane?
The IUPAC name of [(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane (CID 102213211) is [(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane.
What is the SMILES notation for [(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane?
The canonical SMILES for [(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane is CC[Si](CC)(CC)C/C(C)=C(/C)CC1CCCCC1.
What is the InChIKey of [(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane?
The InChIKey is LUNPWBVPZMQHBG-MSUUIHNZSA-N. The full InChI is InChI=1S/C18H36Si/c1-6-19(7-2,8-3)15-17(5)16(4)14-18-12-10-9-11-13-18/h18H,6-15H2,1-5H3/b17-16-.
What are the key properties of [(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane?
[(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane has a molecular weight of 280.57 g/mol, XLogP of 6.80, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4-cyclohexyl-2,3-dimethylbut-2-enyl]-triethylsilane is sourced from PubChem (CID 102213211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).