C8H14O3 — CID 102213219
[(1R,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]methanol (PubChem CID 102213219) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is [(1R,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 102213219 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | [(1R,5S)-5-(methoxymethoxy)cyclopent-2-en-1-yl]methanol |
| SMILES | COCO[C@H]1CC=C[C@@H]1CO |
| InChI | InChI=1S/C8H14O3/c1-10-6-11-8-4-2-3-7(8)5-9/h2-3,7-9H,4-6H2,1H3/t7-,8+/m1/s1 |
| InChIKey | NIHORPRSCCGZPO-SFYZADRCSA-N |
| XLogP | 0.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|