C15H12N4S — CID 10221338
13-methyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 10221338) has the molecular formula C15H12N4S and a molecular weight of 280.36 g/mol. Its IUPAC name is 13-methyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 13-methyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 10221338 |
| Molecular Formula | C15H12N4S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 13-methyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1nnc2n1-c1sccc1C(c1ccccc1)=NC2 |
| InChI | InChI=1S/C15H12N4S/c1-10-17-18-13-9-16-14(11-5-3-2-4-6-11)12-7-8-20-15(12)19(10)13/h2-8H,9H2,1H3 |
| InChIKey | SIRFTOWPWPCSOP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |