C19H35IO5Si2 — CID 102213382
(5R,6R,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-iodo-1,3-dioxaspiro[4.4]non-8-en-2-one (PubChem CID 102213382) has the molecular formula C19H35IO5Si2 and a molecular weight of 526.56 g/mol. Its IUPAC name is (5R,6R,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-iodo-1,3-dioxaspiro[4.4]non-8-en-2-one.
| Compound Name | (5R,6R,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-iodo-1,3-dioxaspiro[4.4]non-8-en-2-one |
|---|---|
| PubChem CID | 102213382 |
| Molecular Formula | C19H35IO5Si2 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | (5R,6R,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-9-iodo-1,3-dioxaspiro[4.4]non-8-en-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C(I)[C@@]2(COC(=O)O2)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H35IO5Si2/c1-17(2,3)26(7,8)24-13-11-14(20)19(12-22-16(21)23-19)15(13)25-27(9,10)18(4,5)6/h11,13,15H,12H2,1-10H3/t13-,15+,19-/m0/s1 |
| InChIKey | IQQQFGIMBOABEN-OHNRDTAOSA-N |
| XLogP | 6.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|