C18H29NO4 — CID 102213659
[(4R,5S)-5-[(1S)-1-[hydroxy-[(1R)-1-phenylpropyl]amino]propyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 102213659) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is [(4R,5S)-5-[(1S)-1-[hydroxy-[(1R)-1-phenylpropyl]amino]propyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4R,5S)-5-[(1S)-1-[hydroxy-[(1R)-1-phenylpropyl]amino]propyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 102213659 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | [(4R,5S)-5-[(1S)-1-[hydroxy-[(1R)-1-phenylpropyl]amino]propyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | CC[C@H](c1ccccc1)N(O)[C@@H](CC)[C@@H]1OC(C)(C)O[C@@H]1CO |
| InChI | InChI=1S/C18H29NO4/c1-5-14(13-10-8-7-9-11-13)19(21)15(6-2)17-16(12-20)22-18(3,4)23-17/h7-11,14-17,20-21H,5-6,12H2,1-4H3/t14-,15+,16-,17+/m1/s1 |
| InChIKey | KLEZXSKEIJXNFV-TWMKSMIVSA-N |
| XLogP | 3.12 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|