C20H29NO4 — CID 102213661
[(4R,5S)-5-[(1S)-1-[hydroxy-[(1R)-1-phenylbut-3-enyl]amino]but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 102213661) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(4R,5S)-5-[(1S)-1-[hydroxy-[(1R)-1-phenylbut-3-enyl]amino]but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4R,5S)-5-[(1S)-1-[hydroxy-[(1R)-1-phenylbut-3-enyl]amino]but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 102213661 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | [(4R,5S)-5-[(1S)-1-[hydroxy-[(1R)-1-phenylbut-3-enyl]amino]but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | C=CC[C@H](c1ccccc1)N(O)[C@@H](CC=C)[C@@H]1OC(C)(C)O[C@@H]1CO |
| InChI | InChI=1S/C20H29NO4/c1-5-10-16(15-12-8-7-9-13-15)21(23)17(11-6-2)19-18(14-22)24-20(3,4)25-19/h5-9,12-13,16-19,22-23H,1-2,10-11,14H2,3-4H3/t16-,17+,18-,19+/m1/s1 |
| InChIKey | ZSVMPPUETWONFU-HCXYKTFWSA-N |
| XLogP | 3.45 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|