C14H19ClN2S — CID 10221408
3-ethyl-11,13-dimethyl-12-thia-3,4-diazatricyclo[8.3.0.02,6]trideca-1(13),2(6),4,10-tetraene;hydrochloride (PubChem CID 10221408) has the molecular formula C14H19ClN2S and a molecular weight of 282.84 g/mol. Its IUPAC name is 3-ethyl-11,13-dimethyl-12-thia-3,4-diazatricyclo[8.3.0.02,6]trideca-1(13),2(6),4,10-tetraene;hydrochloride.
| Compound Name | 3-ethyl-11,13-dimethyl-12-thia-3,4-diazatricyclo[8.3.0.02,6]trideca-1(13),2(6),4,10-tetraene;hydrochloride |
|---|---|
| PubChem CID | 10221408 |
| Molecular Formula | C14H19ClN2S |
| Molecular Weight | 282.84 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-ethyl-11,13-dimethyl-12-thia-3,4-diazatricyclo[8.3.0.02,6]trideca-1(13),2(6),4,10-tetraene;hydrochloride |
| SMILES | CCn1ncc2c1-c1c(C)sc(C)c1CCC2.Cl |
| InChI | InChI=1S/C14H18N2S.ClH/c1-4-16-14-11(8-15-16)6-5-7-12-9(2)17-10(3)13(12)14;/h8H,4-7H2,1-3H3;1H |
| InChIKey | IPSOTQGXWZYDNF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |