C30H34N2O — CID 102214192
3-[3-[5-[3-(1H-indol-3-yl)pentan-3-yl]furan-2-yl]pentan-3-yl]-1H-indole (PubChem CID 102214192) has the molecular formula C30H34N2O and a molecular weight of 438.62 g/mol. Its IUPAC name is 3-[3-[5-[3-(1H-indol-3-yl)pentan-3-yl]furan-2-yl]pentan-3-yl]-1H-indole.
| Compound Name | 3-[3-[5-[3-(1H-indol-3-yl)pentan-3-yl]furan-2-yl]pentan-3-yl]-1H-indole |
|---|---|
| PubChem CID | 102214192 |
| Molecular Formula | C30H34N2O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 3-[3-[5-[3-(1H-indol-3-yl)pentan-3-yl]furan-2-yl]pentan-3-yl]-1H-indole |
| SMILES | CCC(CC)(c1ccc(C(CC)(CC)c2c[nH]c3ccccc23)o1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C30H34N2O/c1-5-29(6-2,23-19-31-25-15-11-9-13-21(23)25)27-17-18-28(33-27)30(7-3,8-4)24-20-32-26-16-12-10-14-22(24)26/h9-20,31-32H,5-8H2,1-4H3 |
| InChIKey | WUXQGKOTRMPLHX-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 44.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |