C19H29IO2 — CID 102215048
(1R,3R,4S,8R,9R,13R)-3-[(2S)-1-iodopropan-2-yl]-6-methyl-9-propan-2-yl-11-oxatricyclo[6.3.2.04,13]tridec-5-en-10-one (PubChem CID 102215048) has the molecular formula C19H29IO2 and a molecular weight of 416.34 g/mol. Its IUPAC name is (1R,3R,4S,8R,9R,13R)-3-[(2S)-1-iodopropan-2-yl]-6-methyl-9-propan-2-yl-11-oxatricyclo[6.3.2.04,13]tridec-5-en-10-one.
| Compound Name | (1R,3R,4S,8R,9R,13R)-3-[(2S)-1-iodopropan-2-yl]-6-methyl-9-propan-2-yl-11-oxatricyclo[6.3.2.04,13]tridec-5-en-10-one |
|---|---|
| PubChem CID | 102215048 |
| Molecular Formula | C19H29IO2 |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (1R,3R,4S,8R,9R,13R)-3-[(2S)-1-iodopropan-2-yl]-6-methyl-9-propan-2-yl-11-oxatricyclo[6.3.2.04,13]tridec-5-en-10-one |
| SMILES | CC1=C[C@@H]2[C@H]([C@H](C)CI)C[C@H]3C[C@@H]2[C@@H](C1)[C@@H](C(C)C)C(=O)O3 |
| InChI | InChI=1S/C19H29IO2/c1-10(2)18-17-6-11(3)5-15-14(12(4)9-20)7-13(8-16(15)17)22-19(18)21/h5,10,12-18H,6-9H2,1-4H3/t12-,13+,14+,15-,16+,17-,18-/m1/s1 |
| InChIKey | FBIKZONJKHWHMC-NYIQUJALSA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|