C38H76Br2Si8 — CID 102215641
26,29-dibromo-1,13-bis(ethenyl)-4,4,7,7,10,10,16,16,19,19,22,22-dodecamethyl-1,4,7,10,13,16,19,22-octasilatricyclo[11.11.4.225,28]triaconta-25(30),26,28-triene (PubChem CID 102215641) has the molecular formula C38H76Br2Si8 and a molecular weight of 917.52 g/mol. Its IUPAC name is 26,29-dibromo-1,13-bis(ethenyl)-4,4,7,7,10,10,16,16,19,19,22,22-dodecamethyl-1,4,7,10,13,16,19,22-octasilatricyclo[11.11.4.225,28]triaconta-25(30),26,28-triene.
| Compound Name | 26,29-dibromo-1,13-bis(ethenyl)-4,4,7,7,10,10,16,16,19,19,22,22-dodecamethyl-1,4,7,10,13,16,19,22-octasilatricyclo[11.11.4.225,28]triaconta-25(30),26,28-triene |
|---|---|
| PubChem CID | 102215641 |
| Molecular Formula | C38H76Br2Si8 |
| Molecular Weight | 917.52 g/mol |
| Exact Mass | 914.25 |
| IUPAC Name | 26,29-dibromo-1,13-bis(ethenyl)-4,4,7,7,10,10,16,16,19,19,22,22-dodecamethyl-1,4,7,10,13,16,19,22-octasilatricyclo[11.11.4.225,28]triaconta-25(30),26,28-triene |
| SMILES | C=C[Si]12CC[Si](C)(C)CC[Si](C)(C)CC[Si](C)(C)CC[Si](C=C)(CC[Si](C)(C)CC[Si](C)(C)CC[Si](C)(C)CC1)c1cc(Br)c2cc1Br |
| InChI | InChI=1S/C38H76Br2Si8/c1-15-47-29-25-43(7,8)21-17-41(3,4)19-23-45(11,12)27-31-48(16-2,38-34-35(39)37(47)33-36(38)40)32-28-46(13,14)24-20-42(5,6)18-22-44(9,10)26-30-47/h15-16,33-34H,1-2,17-32H2,3-14H3 |
| InChIKey | AIDILNCJEQTNAJ-UHFFFAOYSA-N |
| XLogP | 14.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.52 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|