C38H58O8 — CID 102215732
(2E,4E)-7-[20-[(3E)-hexa-3,5-dienyl]-12,21-dihydroxy-10,15,21-trimethyl-4,9,14,19,25-pentaoxapentacyclo[13.10.0.03,13.05,10.018,24]pentacosan-8-yl]-3,4-dimethylhepta-2,4-dienal (PubChem CID 102215732) has the molecular formula C38H58O8 and a molecular weight of 642.87 g/mol. Its IUPAC name is (2E,4E)-7-[20-[(3E)-hexa-3,5-dienyl]-12,21-dihydroxy-10,15,21-trimethyl-4,9,14,19,25-pentaoxapentacyclo[13.10.0.03,13.05,10.018,24]pentacosan-8-yl]-3,4-dimethylhepta-2,4-dienal.
| Compound Name | (2E,4E)-7-[20-[(3E)-hexa-3,5-dienyl]-12,21-dihydroxy-10,15,21-trimethyl-4,9,14,19,25-pentaoxapentacyclo[13.10.0.03,13.05,10.018,24]pentacosan-8-yl]-3,4-dimethylhepta-2,4-dienal |
|---|---|
| PubChem CID | 102215732 |
| Molecular Formula | C38H58O8 |
| Molecular Weight | 642.87 g/mol |
| Exact Mass | 642.41 |
| IUPAC Name | (2E,4E)-7-[20-[(3E)-hexa-3,5-dienyl]-12,21-dihydroxy-10,15,21-trimethyl-4,9,14,19,25-pentaoxapentacyclo[13.10.0.03,13.05,10.018,24]pentacosan-8-yl]-3,4-dimethylhepta-2,4-dienal |
| SMILES | C=C/C=C/CCC1OC2CCC3(C)OC4C(O)CC5(C)OC(CC/C=C(C)/C(C)=C/C=O)CCC5OC4CC3OC2CCC1(C)O |
| InChI | InChI=1S/C38H58O8/c1-7-8-9-10-14-32-36(4,41)20-17-29-30(42-32)18-21-37(5)34(43-29)23-31-35(46-37)28(40)24-38(6)33(44-31)16-15-27(45-38)13-11-12-25(2)26(3)19-22-39/h7-9,12,19,22,27-35,40-41H,1,10-11,13-18,20-21,23-24H2,2-6H3/b9-8+,25-12+,26-19+ |
| InChIKey | XCHRPPYDBZCUGV-ATQGULNZSA-N |
| XLogP | 6.23 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.87 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|