About 3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol
3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol (PubChem CID 102215965) has the molecular formula C17H24NO2-
and a molecular weight of 274.38 g/mol. Its IUPAC name is 3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol.
Molecular Properties
| Compound Name | 3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol |
| PubChem CID | 102215965 |
| Molecular Formula | C17H24NO2- |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol |
| SMILES | CC1(C#CCO)CCC2(C3CC4CC(C3)CC2C4)N1[O-] |
| InChI | InChI=1S/C17H24NO2/c1-16(3-2-6-19)4-5-17(18(16)20)14-8-12-7-13(10-14)11-15(17)9-12/h12-15,19H,4-11H2,1H3/q-1 |
| InChIKey | ZDHYZOTXCUHXHO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol?
The IUPAC name of 3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol (CID 102215965) is 3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol.
What is the SMILES notation for 3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol?
The canonical SMILES for 3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol is CC1(C#CCO)CCC2(C3CC4CC(C3)CC2C4)N1[O-].
What is the InChIKey of 3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol?
The InChIKey is ZDHYZOTXCUHXHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24NO2/c1-16(3-2-6-19)4-5-17(18(16)20)14-8-12-7-13(10-14)11-15(17)9-12/h12-15,19H,4-11H2,1H3/q-1.
What are the key properties of 3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol?
3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol has a molecular weight of 274.38 g/mol, XLogP of 2.53, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2'-methyl-1'-oxidospiro[adamantane-2,5'-pyrrolidine]-2'-yl)prop-2-yn-1-ol is sourced from PubChem (CID 102215965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).