C8H2F12N6 — CID 102216198
1-N,1-N,2-N,2-N,3-N,3-N,4-N,4-N,5-N,5-N,7-N,7-N-dodecafluorocubane-1,2,3,4,5,7-hexamine (PubChem CID 102216198) has the molecular formula C8H2F12N6 and a molecular weight of 410.12 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N,3-N,3-N,4-N,4-N,5-N,5-N,7-N,7-N-dodecafluorocubane-1,2,3,4,5,7-hexamine.
| Compound Name | 1-N,1-N,2-N,2-N,3-N,3-N,4-N,4-N,5-N,5-N,7-N,7-N-dodecafluorocubane-1,2,3,4,5,7-hexamine |
|---|---|
| PubChem CID | 102216198 |
| Molecular Formula | C8H2F12N6 |
| Molecular Weight | 410.12 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | 1-N,1-N,2-N,2-N,3-N,3-N,4-N,4-N,5-N,5-N,7-N,7-N-dodecafluorocubane-1,2,3,4,5,7-hexamine |
| SMILES | FN(F)C12C3C4(N(F)F)C1C1(N(F)F)C2(N(F)F)C3(N(F)F)C41N(F)F |
| InChI | InChI=1S/C8H2F12N6/c9-21(10)3-1-4(22(11)12)2(3)6(24(15)16)7(3,25(17)18)5(1,23(13)14)8(4,6)26(19)20/h1-2H |
| InChIKey | GIVCHVZVPASUPD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|