C20H20N2O4S — CID 10221625
5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxy-N-[(4-methylphenyl)methyl]benzamide (PubChem CID 10221625) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxy-N-[(4-methylphenyl)methyl]benzamide.
| Compound Name | 5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxy-N-[(4-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 10221625 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxy-N-[(4-methylphenyl)methyl]benzamide |
| SMILES | COc1ccc(CC2SC(=O)NC2=O)cc1C(=O)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-12-3-5-13(6-4-12)11-21-18(23)15-9-14(7-8-16(15)26-2)10-17-19(24)22-20(25)27-17/h3-9,17H,10-11H2,1-2H3,(H,21,23)(H,22,24,25) |
| InChIKey | YGEKRXCIQJDLDQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|