C25H44O2Si — CID 102216674
(1R,2R,3R,4R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,7,7-trimethyl-3-(5-prop-2-enylcyclopenten-1-yl)bicyclo[4.1.0]heptan-3-ol (PubChem CID 102216674) has the molecular formula C25H44O2Si and a molecular weight of 404.71 g/mol. Its IUPAC name is (1R,2R,3R,4R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,7,7-trimethyl-3-(5-prop-2-enylcyclopenten-1-yl)bicyclo[4.1.0]heptan-3-ol.
| Compound Name | (1R,2R,3R,4R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,7,7-trimethyl-3-(5-prop-2-enylcyclopenten-1-yl)bicyclo[4.1.0]heptan-3-ol |
|---|---|
| PubChem CID | 102216674 |
| Molecular Formula | C25H44O2Si |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | (1R,2R,3R,4R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,7,7-trimethyl-3-(5-prop-2-enylcyclopenten-1-yl)bicyclo[4.1.0]heptan-3-ol |
| SMILES | C=CCC1CCC=C1[C@@]1(O)[C@H](C)C[C@@H]2[C@H]([C@@H]1CO[Si](C)(C)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C25H44O2Si/c1-10-12-18-13-11-14-19(18)25(26)17(2)15-20-22(24(20,6)7)21(25)16-27-28(8,9)23(3,4)5/h10,14,17-18,20-22,26H,1,11-13,15-16H2,2-9H3/t17-,18?,20-,21+,22-,25+/m1/s1 |
| InChIKey | BYJKKCHYAMBTLR-ILCVUAIOSA-N |
| XLogP | 6.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|