C34H43N3O3 — CID 102216824
methyl 1,7-dibenzyl-5-(1-morpholin-4-ylheptyl)-2,3-dihydropyrrolo[2,3-c]pyridine-4-carboxylate (PubChem CID 102216824) has the molecular formula C34H43N3O3 and a molecular weight of 541.74 g/mol. Its IUPAC name is methyl 1,7-dibenzyl-5-(1-morpholin-4-ylheptyl)-2,3-dihydropyrrolo[2,3-c]pyridine-4-carboxylate.
| Compound Name | methyl 1,7-dibenzyl-5-(1-morpholin-4-ylheptyl)-2,3-dihydropyrrolo[2,3-c]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 102216824 |
| Molecular Formula | C34H43N3O3 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | methyl 1,7-dibenzyl-5-(1-morpholin-4-ylheptyl)-2,3-dihydropyrrolo[2,3-c]pyridine-4-carboxylate |
| SMILES | CCCCCCC(c1nc(Cc2ccccc2)c2c(c1C(=O)OC)CCN2Cc1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C34H43N3O3/c1-3-4-5-12-17-30(36-20-22-40-23-21-36)32-31(34(38)39-2)28-18-19-37(25-27-15-10-7-11-16-27)33(28)29(35-32)24-26-13-8-6-9-14-26/h6-11,13-16,30H,3-5,12,17-25H2,1-2H3 |
| InChIKey | WSPMQDFBOOTLRG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|