C22H28O2Se — CID 102216952
ethyl 2-(3',3'-dimethyl-2'-methylidenespiro[1,3-dihydroindene-2,7'-bicyclo[2.2.1]heptane]-1'-yl)selanylacetate (PubChem CID 102216952) has the molecular formula C22H28O2Se and a molecular weight of 403.42 g/mol. Its IUPAC name is ethyl 2-(3',3'-dimethyl-2'-methylidenespiro[1,3-dihydroindene-2,7'-bicyclo[2.2.1]heptane]-1'-yl)selanylacetate.
| Compound Name | ethyl 2-(3',3'-dimethyl-2'-methylidenespiro[1,3-dihydroindene-2,7'-bicyclo[2.2.1]heptane]-1'-yl)selanylacetate |
|---|---|
| PubChem CID | 102216952 |
| Molecular Formula | C22H28O2Se |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | ethyl 2-(3',3'-dimethyl-2'-methylidenespiro[1,3-dihydroindene-2,7'-bicyclo[2.2.1]heptane]-1'-yl)selanylacetate |
| SMILES | C=C1C(C)(C)C2CCC1([Se]CC(=O)OCC)C21Cc2ccccc2C1 |
| InChI | InChI=1S/C22H28O2Se/c1-5-24-19(23)14-25-22-11-10-18(20(3,4)15(22)2)21(22)12-16-8-6-7-9-17(16)13-21/h6-9,18H,2,5,10-14H2,1,3-4H3 |
| InChIKey | CIQHNWIOFWCTPB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|