C25H32O4 — CID 102216954
diethyl 2-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)propanedioate (PubChem CID 102216954) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is diethyl 2-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)propanedioate.
| Compound Name | diethyl 2-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)propanedioate |
|---|---|
| PubChem CID | 102216954 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | diethyl 2-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)=C1C2(Cc3ccccc3C2)C2CCC1(C)C2(C)C |
| InChI | InChI=1S/C25H32O4/c1-6-28-21(26)19(22(27)29-7-2)20-24(5)13-12-18(23(24,3)4)25(20)14-16-10-8-9-11-17(16)15-25/h8-11,18H,6-7,12-15H2,1-5H3 |
| InChIKey | AXRYCDUKKXCBMV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|