About (3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide
(3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide (PubChem CID 102217026) has the molecular formula C10H19ClO5P2
and a molecular weight of 316.66 g/mol. Its IUPAC name is (3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide.
Molecular Properties
| Compound Name | (3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide |
| PubChem CID | 102217026 |
| Molecular Formula | C10H19ClO5P2 |
| Molecular Weight | 316.66 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | (3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide |
| SMILES | CCOP1(=O)CC(C)=C(Cl)[C@H](P(=O)(OC)OC)C1 |
| InChI | InChI=1S/C10H19ClO5P2/c1-5-16-17(12)6-8(2)10(11)9(7-17)18(13,14-3)15-4/h9H,5-7H2,1-4H3/t9-,17?/m1/s1 |
| InChIKey | BMIREFYMEQSYFB-SUSUGVNDSA-N |
| XLogP | 3.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide?
The IUPAC name of (3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide (CID 102217026) is (3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide.
What is the SMILES notation for (3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide?
The canonical SMILES for (3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide is CCOP1(=O)CC(C)=C(Cl)[C@H](P(=O)(OC)OC)C1.
What is the InChIKey of (3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide?
The InChIKey is BMIREFYMEQSYFB-SUSUGVNDSA-N. The full InChI is InChI=1S/C10H19ClO5P2/c1-5-16-17(12)6-8(2)10(11)9(7-17)18(13,14-3)15-4/h9H,5-7H2,1-4H3/t9-,17?/m1/s1.
What are the key properties of (3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide?
(3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide has a molecular weight of 316.66 g/mol, XLogP of 3.68, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-chloro-3-dimethoxyphosphoryl-1-ethoxy-5-methyl-3,6-dihydro-2H-1λ5-phosphinine 1-oxide is sourced from PubChem (CID 102217026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).