About (3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide
(3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide (PubChem CID 102217029) has the molecular formula C12H26O5P2
and a molecular weight of 312.28 g/mol. Its IUPAC name is (3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide.
Molecular Properties
| Compound Name | (3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide |
| PubChem CID | 102217029 |
| Molecular Formula | C12H26O5P2 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide |
| SMILES | CCOP1(=O)C[C@@H](C)C[C@H](P(=O)(OCC)OCC)C1 |
| InChI | InChI=1S/C12H26O5P2/c1-5-15-18(13)9-11(4)8-12(10-18)19(14,16-6-2)17-7-3/h11-12H,5-10H2,1-4H3/t11-,12-,18?/m0/s1 |
| InChIKey | CMCGJAJWHOFYMN-WOWAASLYSA-N |
| XLogP | 3.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide?
The IUPAC name of (3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide (CID 102217029) is (3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide.
What is the SMILES notation for (3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide?
The canonical SMILES for (3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide is CCOP1(=O)C[C@@H](C)C[C@H](P(=O)(OCC)OCC)C1.
What is the InChIKey of (3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide?
The InChIKey is CMCGJAJWHOFYMN-WOWAASLYSA-N. The full InChI is InChI=1S/C12H26O5P2/c1-5-15-18(13)9-11(4)8-12(10-18)19(14,16-6-2)17-7-3/h11-12H,5-10H2,1-4H3/t11-,12-,18?/m0/s1.
What are the key properties of (3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide?
(3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide has a molecular weight of 312.28 g/mol, XLogP of 3.98, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-3-diethoxyphosphoryl-1-ethoxy-5-methyl-1λ5-phosphinane 1-oxide is sourced from PubChem (CID 102217029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).