C16H14N2O7 — CID 102217047
(1S,2R,6R,8R,9R)-9-(5-nitro-1H-indol-3-yl)-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecan-11-one (PubChem CID 102217047) has the molecular formula C16H14N2O7 and a molecular weight of 346.30 g/mol. Its IUPAC name is (1S,2R,6R,8R,9R)-9-(5-nitro-1H-indol-3-yl)-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecan-11-one.
| Compound Name | (1S,2R,6R,8R,9R)-9-(5-nitro-1H-indol-3-yl)-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecan-11-one |
|---|---|
| PubChem CID | 102217047 |
| Molecular Formula | C16H14N2O7 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | (1S,2R,6R,8R,9R)-9-(5-nitro-1H-indol-3-yl)-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecan-11-one |
| SMILES | O=C1C[C@H](c2c[nH]c3ccc([N+](=O)[O-])cc23)[C@H]2O[C@@H]3OCO[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C16H14N2O7/c19-12-4-9(13-14(24-12)15-16(25-13)23-6-22-15)10-5-17-11-2-1-7(18(20)21)3-8(10)11/h1-3,5,9,13-17H,4,6H2/t9-,13-,14+,15-,16+/m1/s1 |
| InChIKey | RZBPFRMHEIKKFE-PKDMHSDKSA-N |
| XLogP | 1.57 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|