C29H24N2O3 — CID 102217092
N,N-diethyl-2-methyl-2',5-dioxospiro[1H-indeno[1,2-b]pyridine-4,1'-acenaphthylene]-3-carboxamide (PubChem CID 102217092) has the molecular formula C29H24N2O3 and a molecular weight of 448.52 g/mol. Its IUPAC name is N,N-diethyl-2-methyl-2',5-dioxospiro[1H-indeno[1,2-b]pyridine-4,1'-acenaphthylene]-3-carboxamide.
| Compound Name | N,N-diethyl-2-methyl-2',5-dioxospiro[1H-indeno[1,2-b]pyridine-4,1'-acenaphthylene]-3-carboxamide |
|---|---|
| PubChem CID | 102217092 |
| Molecular Formula | C29H24N2O3 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N,N-diethyl-2-methyl-2',5-dioxospiro[1H-indeno[1,2-b]pyridine-4,1'-acenaphthylene]-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)NC2=C(C(=O)c3ccccc32)C12C(=O)c1cccc3cccc2c13 |
| InChI | InChI=1S/C29H24N2O3/c1-4-31(5-2)28(34)23-16(3)30-25-18-12-6-7-13-19(18)26(32)24(25)29(23)21-15-9-11-17-10-8-14-20(22(17)21)27(29)33/h6-15,30H,4-5H2,1-3H3 |
| InChIKey | BVSZMOFNGURWDR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'} |
|---|