C94H112N2O6 — CID 102217516
5,12-bis[[3,5-bis[(3,5-ditert-butylphenyl)methoxy]phenyl]methyl]quinolino[2,3-b]acridine-7,14-dione (PubChem CID 102217516) has the molecular formula C94H112N2O6 and a molecular weight of 1365.94 g/mol. Its IUPAC name is 5,12-bis[[3,5-bis[(3,5-ditert-butylphenyl)methoxy]phenyl]methyl]quinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 5,12-bis[[3,5-bis[(3,5-ditert-butylphenyl)methoxy]phenyl]methyl]quinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 102217516 |
| Molecular Formula | C94H112N2O6 |
| Molecular Weight | 1365.94 g/mol |
| Exact Mass | 1364.85 |
| IUPAC Name | 5,12-bis[[3,5-bis[(3,5-ditert-butylphenyl)methoxy]phenyl]methyl]quinolino[2,3-b]acridine-7,14-dione |
| SMILES | CC(C)(C)c1cc(COc2cc(Cn3c4ccccc4c(=O)c4cc5c(cc43)c(=O)c3ccccc3n5Cc3cc(OCc4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc(OCc4cc(C(C)(C)C)cc(C(C)(C)C)c4)c3)cc(OCc3cc(C(C)(C)C)cc(C(C)(C)C)c3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C94H112N2O6/c1-87(2,3)65-33-61(34-66(45-65)88(4,5)6)55-99-73-41-59(42-74(49-73)100-56-62-35-67(89(7,8)9)46-68(36-62)90(10,11)12)53-95-81-31-27-25-29-77(81)85(97)79-52-84-80(51-83(79)95)86(98)78-30-26-28-32-82(78)96(84)54-60-43-75(101-57-63-37-69(91(13,14)15)47-70(38-63)92(16,17)18)50-76(44-60)102-58-64-39-71(93(19,20)21)48-72(40-64)94(22,23)24/h25-52H,53-58H2,1-24H3 |
| InChIKey | OJZGKOKEAGDGMZ-UHFFFAOYSA-N |
| XLogP | 23.42 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 102 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1365.94 |
| LogP ≤ 5 | 23.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|