C42H30BF10N3S — CID 102218225
2-[5-(3,6-ditert-butylcarbazol-9-yl)thiophen-2-yl]-1,3-bis(2,3,4,5,6-pentafluorophenyl)-1,3,2-benzodiazaborole (PubChem CID 102218225) has the molecular formula C42H30BF10N3S and a molecular weight of 809.58 g/mol. Its IUPAC name is 2-[5-(3,6-ditert-butylcarbazol-9-yl)thiophen-2-yl]-1,3-bis(2,3,4,5,6-pentafluorophenyl)-1,3,2-benzodiazaborole.
| Compound Name | 2-[5-(3,6-ditert-butylcarbazol-9-yl)thiophen-2-yl]-1,3-bis(2,3,4,5,6-pentafluorophenyl)-1,3,2-benzodiazaborole |
|---|---|
| PubChem CID | 102218225 |
| Molecular Formula | C42H30BF10N3S |
| Molecular Weight | 809.58 g/mol |
| Exact Mass | 809.21 |
| IUPAC Name | 2-[5-(3,6-ditert-butylcarbazol-9-yl)thiophen-2-yl]-1,3-bis(2,3,4,5,6-pentafluorophenyl)-1,3,2-benzodiazaborole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(B2N(c3c(F)c(F)c(F)c(F)c3F)c3ccccc3N2c2c(F)c(F)c(F)c(F)c2F)s1 |
| InChI | InChI=1S/C42H30BF10N3S/c1-41(2,3)19-11-13-23-21(17-19)22-18-20(42(4,5)6)12-14-24(22)54(23)28-16-15-27(57-28)43-55(39-35(50)31(46)29(44)32(47)36(39)51)25-9-7-8-10-26(25)56(43)40-37(52)33(48)30(45)34(49)38(40)53/h7-18H,1-6H3 |
| InChIKey | GYOXRQURKVNJOR-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.58 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|