C22H24F2O6S — CID 102218531
5,5-difluoro-4,4-bis[(4-methoxyphenyl)methoxymethyl]-1,3-dioxane-2-thione (PubChem CID 102218531) has the molecular formula C22H24F2O6S and a molecular weight of 454.49 g/mol. Its IUPAC name is 5,5-difluoro-4,4-bis[(4-methoxyphenyl)methoxymethyl]-1,3-dioxane-2-thione.
| Compound Name | 5,5-difluoro-4,4-bis[(4-methoxyphenyl)methoxymethyl]-1,3-dioxane-2-thione |
|---|---|
| PubChem CID | 102218531 |
| Molecular Formula | C22H24F2O6S |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 5,5-difluoro-4,4-bis[(4-methoxyphenyl)methoxymethyl]-1,3-dioxane-2-thione |
| SMILES | COc1ccc(COCC2(COCc3ccc(OC)cc3)OC(=S)OCC2(F)F)cc1 |
| InChI | InChI=1S/C22H24F2O6S/c1-25-18-7-3-16(4-8-18)11-27-13-21(22(23,24)15-29-20(31)30-21)14-28-12-17-5-9-19(26-2)10-6-17/h3-10H,11-15H2,1-2H3 |
| InChIKey | YYCCLXVWXVZAIF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|