C20H17FO5S — CID 10221859
3-(2-fluoro-4-methylphenoxy)-6-methyl-2-(4-methylsulfonylphenyl)pyran-4-one (PubChem CID 10221859) has the molecular formula C20H17FO5S and a molecular weight of 388.42 g/mol. Its IUPAC name is 3-(2-fluoro-4-methylphenoxy)-6-methyl-2-(4-methylsulfonylphenyl)pyran-4-one.
| Compound Name | 3-(2-fluoro-4-methylphenoxy)-6-methyl-2-(4-methylsulfonylphenyl)pyran-4-one |
|---|---|
| PubChem CID | 10221859 |
| Molecular Formula | C20H17FO5S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 3-(2-fluoro-4-methylphenoxy)-6-methyl-2-(4-methylsulfonylphenyl)pyran-4-one |
| SMILES | Cc1ccc(Oc2c(-c3ccc(S(C)(=O)=O)cc3)oc(C)cc2=O)c(F)c1 |
| InChI | InChI=1S/C20H17FO5S/c1-12-4-9-18(16(21)10-12)26-20-17(22)11-13(2)25-19(20)14-5-7-15(8-6-14)27(3,23)24/h4-11H,1-3H3 |
| InChIKey | JAIOAMPOGJIYQK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |