C17H30Si — CID 102218782
trimethyl-(2,3,4,5-tetraethylphenyl)silane (PubChem CID 102218782) has the molecular formula C17H30Si and a molecular weight of 262.51 g/mol. Its IUPAC name is trimethyl-(2,3,4,5-tetraethylphenyl)silane.
| Compound Name | trimethyl-(2,3,4,5-tetraethylphenyl)silane |
|---|---|
| PubChem CID | 102218782 |
| Molecular Formula | C17H30Si |
| Molecular Weight | 262.51 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | trimethyl-(2,3,4,5-tetraethylphenyl)silane |
| SMILES | CCc1cc([Si](C)(C)C)c(CC)c(CC)c1CC |
| InChI | InChI=1S/C17H30Si/c1-8-13-12-17(18(5,6)7)16(11-4)15(10-3)14(13)9-2/h12H,8-11H2,1-7H3 |
| InChIKey | RVQAYORIXBUOGH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|