C16H19FO2S — CID 102218877
2-(4-fluorophenyl)sulfanyl-3,4-dipropyl-2H-furan-5-one (PubChem CID 102218877) has the molecular formula C16H19FO2S and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-3,4-dipropyl-2H-furan-5-one.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-3,4-dipropyl-2H-furan-5-one |
|---|---|
| PubChem CID | 102218877 |
| Molecular Formula | C16H19FO2S |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-3,4-dipropyl-2H-furan-5-one |
| SMILES | CCCC1=C(CCC)C(Sc2ccc(F)cc2)OC1=O |
| InChI | InChI=1S/C16H19FO2S/c1-3-5-13-14(6-4-2)16(19-15(13)18)20-12-9-7-11(17)8-10-12/h7-10,16H,3-6H2,1-2H3 |
| InChIKey | ZYMMBNBKXQTOHL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |