About 4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline
4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline (PubChem CID 102218944) has the molecular formula C16H14ClN
and a molecular weight of 255.75 g/mol. Its IUPAC name is 4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline |
| PubChem CID | 102218944 |
| Molecular Formula | C16H14ClN |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C#Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C16H14ClN/c1-18(2)15-11-8-13(9-12-15)7-10-14-5-3-4-6-16(14)17/h3-6,8-9,11-12H,1-2H3 |
| InChIKey | INOUEKQTMWVXDO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline?
The IUPAC name of 4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline (CID 102218944) is 4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline.
What is the SMILES notation for 4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline?
The canonical SMILES for 4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline is CN(C)c1ccc(C#Cc2ccccc2Cl)cc1.
What is the InChIKey of 4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline?
The InChIKey is INOUEKQTMWVXDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN/c1-18(2)15-11-8-13(9-12-15)7-10-14-5-3-4-6-16(14)17/h3-6,8-9,11-12H,1-2H3.
What are the key properties of 4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline?
4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline has a molecular weight of 255.75 g/mol, XLogP of 3.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-chlorophenyl)ethynyl]-N,N-dimethylaniline is sourced from PubChem (CID 102218944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).