C26H23FN4O4 — CID 102219362
3-(1,2-benzoxazol-3-yl)-4-[6-fluoro-1-(3-morpholin-4-ylpropyl)indol-3-yl]pyrrole-2,5-dione (PubChem CID 102219362) has the molecular formula C26H23FN4O4 and a molecular weight of 474.49 g/mol. Its IUPAC name is 3-(1,2-benzoxazol-3-yl)-4-[6-fluoro-1-(3-morpholin-4-ylpropyl)indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1,2-benzoxazol-3-yl)-4-[6-fluoro-1-(3-morpholin-4-ylpropyl)indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 102219362 |
| Molecular Formula | C26H23FN4O4 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 3-(1,2-benzoxazol-3-yl)-4-[6-fluoro-1-(3-morpholin-4-ylpropyl)indol-3-yl]pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CCCN3CCOCC3)c3cc(F)ccc23)=C1c1noc2ccccc12 |
| InChI | InChI=1S/C26H23FN4O4/c27-16-6-7-17-19(15-31(20(17)14-16)9-3-8-30-10-12-34-13-11-30)22-23(26(33)28-25(22)32)24-18-4-1-2-5-21(18)35-29-24/h1-2,4-7,14-15H,3,8-13H2,(H,28,32,33) |
| InChIKey | NIYAFHYOIYHMNM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|