C30H49N — CID 102219504
2-benzyl-1-tert-butyl-4-decyl-3-(2,2-dimethylpropyl)pyrrole (PubChem CID 102219504) has the molecular formula C30H49N and a molecular weight of 423.73 g/mol. Its IUPAC name is 2-benzyl-1-tert-butyl-4-decyl-3-(2,2-dimethylpropyl)pyrrole.
| Compound Name | 2-benzyl-1-tert-butyl-4-decyl-3-(2,2-dimethylpropyl)pyrrole |
|---|---|
| PubChem CID | 102219504 |
| Molecular Formula | C30H49N |
| Molecular Weight | 423.73 g/mol |
| Exact Mass | 423.39 |
| IUPAC Name | 2-benzyl-1-tert-butyl-4-decyl-3-(2,2-dimethylpropyl)pyrrole |
| SMILES | CCCCCCCCCCc1cn(C(C)(C)C)c(Cc2ccccc2)c1CC(C)(C)C |
| InChI | InChI=1S/C30H49N/c1-8-9-10-11-12-13-14-18-21-26-24-31(30(5,6)7)28(27(26)23-29(2,3)4)22-25-19-16-15-17-20-25/h15-17,19-20,24H,8-14,18,21-23H2,1-7H3 |
| InChIKey | XTRKJKIYTFELJS-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.73 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|