C13H14ClN3O — CID 102220650
(5S)-4-chloro-1,2',3-trimethylspiro[4H-pyrazole-5,3'-isoindole]-1'-one (PubChem CID 102220650) has the molecular formula C13H14ClN3O and a molecular weight of 263.73 g/mol. Its IUPAC name is (5S)-4-chloro-1,2',3-trimethylspiro[4H-pyrazole-5,3'-isoindole]-1'-one.
| Compound Name | (5S)-4-chloro-1,2',3-trimethylspiro[4H-pyrazole-5,3'-isoindole]-1'-one |
|---|---|
| PubChem CID | 102220650 |
| Molecular Formula | C13H14ClN3O |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (5S)-4-chloro-1,2',3-trimethylspiro[4H-pyrazole-5,3'-isoindole]-1'-one |
| SMILES | CC1=NN(C)[C@@]2(c3ccccc3C(=O)N2C)C1Cl |
| InChI | InChI=1S/C13H14ClN3O/c1-8-11(14)13(17(3)15-8)10-7-5-4-6-9(10)12(18)16(13)2/h4-7,11H,1-3H3/t11?,13-/m0/s1 |
| InChIKey | ZFALSNFVSDAGKJ-YUZLPWPTSA-N |
| XLogP | 1.85 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|