C21H29NO4S — CID 10222073
3-phenylpropyl (4R)-3-(3,3-dimethyl-2-oxobutanoyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate (PubChem CID 10222073) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is 3-phenylpropyl (4R)-3-(3,3-dimethyl-2-oxobutanoyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | 3-phenylpropyl (4R)-3-(3,3-dimethyl-2-oxobutanoyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 10222073 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 3-phenylpropyl (4R)-3-(3,3-dimethyl-2-oxobutanoyl)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CC(C)(C)C(=O)C(=O)N1[C@H](C(=O)OCCCc2ccccc2)CSC1(C)C |
| InChI | InChI=1S/C21H29NO4S/c1-20(2,3)17(23)18(24)22-16(14-27-21(22,4)5)19(25)26-13-9-12-15-10-7-6-8-11-15/h6-8,10-11,16H,9,12-14H2,1-5H3/t16-/m0/s1 |
| InChIKey | SPTHYMVSCVJAOF-INIZCTEOSA-N |
| XLogP | 3.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|