C26H23NO3 — CID 102220928
(3S,3'S)-1-benzyl-3'-ethyl-3'-(4-methylphenyl)spiro[indole-3,4'-oxetane]-2,2'-dione (PubChem CID 102220928) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is (3S,3'S)-1-benzyl-3'-ethyl-3'-(4-methylphenyl)spiro[indole-3,4'-oxetane]-2,2'-dione.
| Compound Name | (3S,3'S)-1-benzyl-3'-ethyl-3'-(4-methylphenyl)spiro[indole-3,4'-oxetane]-2,2'-dione |
|---|---|
| PubChem CID | 102220928 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (3S,3'S)-1-benzyl-3'-ethyl-3'-(4-methylphenyl)spiro[indole-3,4'-oxetane]-2,2'-dione |
| SMILES | CC[C@@]1(c2ccc(C)cc2)C(=O)O[C@]12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C26H23NO3/c1-3-25(20-15-13-18(2)14-16-20)24(29)30-26(25)21-11-7-8-12-22(21)27(23(26)28)17-19-9-5-4-6-10-19/h4-16H,3,17H2,1-2H3/t25-,26-/m1/s1 |
| InChIKey | VTNPKWLPOLBOSR-CLJLJLNGSA-N |
| XLogP | 4.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|