C12H15IO7 — CID 102221012
[(2R,3R,4S)-3,4-diacetyloxy-5-iodo-3,4-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 102221012) has the molecular formula C12H15IO7 and a molecular weight of 398.15 g/mol. Its IUPAC name is [(2R,3R,4S)-3,4-diacetyloxy-5-iodo-3,4-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S)-3,4-diacetyloxy-5-iodo-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102221012 |
| Molecular Formula | C12H15IO7 |
| Molecular Weight | 398.15 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | [(2R,3R,4S)-3,4-diacetyloxy-5-iodo-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC=C(I)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H15IO7/c1-6(14)17-5-10-12(20-8(3)16)11(19-7(2)15)9(13)4-18-10/h4,10-12H,5H2,1-3H3/t10-,11-,12-/m1/s1 |
| InChIKey | WFNKIWQIEHAHQU-IJLUTSLNSA-N |
| XLogP | 1.09 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.15 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|