C32H28N2O6S4 — CID 102221341
ditert-butyl 3,6-dioxo-1,4-bis(5-thiophen-2-ylthiophen-2-yl)pyrrolo[3,4-c]pyrrole-2,5-dicarboxylate (PubChem CID 102221341) has the molecular formula C32H28N2O6S4 and a molecular weight of 664.85 g/mol. Its IUPAC name is ditert-butyl 3,6-dioxo-1,4-bis(5-thiophen-2-ylthiophen-2-yl)pyrrolo[3,4-c]pyrrole-2,5-dicarboxylate.
| Compound Name | ditert-butyl 3,6-dioxo-1,4-bis(5-thiophen-2-ylthiophen-2-yl)pyrrolo[3,4-c]pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 102221341 |
| Molecular Formula | C32H28N2O6S4 |
| Molecular Weight | 664.85 g/mol |
| Exact Mass | 664.08 |
| IUPAC Name | ditert-butyl 3,6-dioxo-1,4-bis(5-thiophen-2-ylthiophen-2-yl)pyrrolo[3,4-c]pyrrole-2,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C2=C(c3ccc(-c4cccs4)s3)N(C(=O)OC(C)(C)C)C(=O)C2=C1c1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C32H28N2O6S4/c1-31(2,3)39-29(37)33-25(21-13-11-19(43-21)17-9-7-15-41-17)23-24(27(33)35)26(34(28(23)36)30(38)40-32(4,5)6)22-14-12-20(44-22)18-10-8-16-42-18/h7-16H,1-6H3 |
| InChIKey | OZMSYUIURSHUNC-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.85 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|