C11H10N6O2 — CID 102221387
7,8,10-trimethylpyrazino[2,3-g]pteridine-2,4-dione (PubChem CID 102221387) has the molecular formula C11H10N6O2 and a molecular weight of 258.24 g/mol. Its IUPAC name is 7,8,10-trimethylpyrazino[2,3-g]pteridine-2,4-dione.
| Compound Name | 7,8,10-trimethylpyrazino[2,3-g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 102221387 |
| Molecular Formula | C11H10N6O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 7,8,10-trimethylpyrazino[2,3-g]pteridine-2,4-dione |
| SMILES | Cc1nc2nc3c(=O)[nH]c(=O)nc-3n(C)c2nc1C |
| InChI | InChI=1S/C11H10N6O2/c1-4-5(2)13-9-7(12-4)14-6-8(17(9)3)15-11(19)16-10(6)18/h1-3H3,(H,16,18,19) |
| InChIKey | IZHAFISSIDIHIJ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|