C13H12N4OS — CID 102221390
7,8,10-trimethyl-4-sulfanylidenebenzo[g]pteridin-2-one (PubChem CID 102221390) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is 7,8,10-trimethyl-4-sulfanylidenebenzo[g]pteridin-2-one.
| Compound Name | 7,8,10-trimethyl-4-sulfanylidenebenzo[g]pteridin-2-one |
|---|---|
| PubChem CID | 102221390 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 7,8,10-trimethyl-4-sulfanylidenebenzo[g]pteridin-2-one |
| SMILES | Cc1cc2nc3c(=S)[nH]c(=O)nc-3n(C)c2cc1C |
| InChI | InChI=1S/C13H12N4OS/c1-6-4-8-9(5-7(6)2)17(3)11-10(14-8)12(19)16-13(18)15-11/h4-5H,1-3H3,(H,16,18,19) |
| InChIKey | IDNDDTMMZUJANE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|