About 6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline
6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline (PubChem CID 102221947) has the molecular formula C17H20ClN
and a molecular weight of 273.81 g/mol. Its IUPAC name is 6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline.
Molecular Properties
| Compound Name | 6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline |
| PubChem CID | 102221947 |
| Molecular Formula | C17H20ClN |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline |
| SMILES | CC1=CC(C)(C)Nc2c1cc(Cl)cc2C1=CCCC1 |
| InChI | InChI=1S/C17H20ClN/c1-11-10-17(2,3)19-16-14(11)8-13(18)9-15(16)12-6-4-5-7-12/h6,8-10,19H,4-5,7H2,1-3H3 |
| InChIKey | CIYKTSVURVXXCR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline?
The IUPAC name of 6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline (CID 102221947) is 6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline.
What is the SMILES notation for 6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline?
The canonical SMILES for 6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline is CC1=CC(C)(C)Nc2c1cc(Cl)cc2C1=CCCC1.
What is the InChIKey of 6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline?
The InChIKey is CIYKTSVURVXXCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN/c1-11-10-17(2,3)19-16-14(11)8-13(18)9-15(16)12-6-4-5-7-12/h6,8-10,19H,4-5,7H2,1-3H3.
What are the key properties of 6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline?
6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline has a molecular weight of 273.81 g/mol, XLogP of 5.51, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-8-(cyclopenten-1-yl)-2,2,4-trimethyl-1H-quinoline is sourced from PubChem (CID 102221947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).