About 2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline
2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline (PubChem CID 102221967) has the molecular formula C24H22N2O4S
and a molecular weight of 434.52 g/mol. Its IUPAC name is 2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline.
Molecular Properties
| Compound Name | 2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline |
| PubChem CID | 102221967 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline |
| SMILES | COc1cc2c(cc1OC)-n1c(cc3ccccc31)N(S(=O)(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C24H22N2O4S/c1-16-8-10-19(11-9-16)31(27,28)25-15-18-12-22(29-2)23(30-3)14-21(18)26-20-7-5-4-6-17(20)13-24(25)26/h4-14H,15H2,1-3H3 |
| InChIKey | JBEULUKGRIRZKB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline?
The IUPAC name of 2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline (CID 102221967) is 2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline.
What is the SMILES notation for 2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline?
The canonical SMILES for 2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline is COc1cc2c(cc1OC)-n1c(cc3ccccc31)N(S(=O)(=O)c1ccc(C)cc1)C2.
What is the InChIKey of 2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline?
The InChIKey is JBEULUKGRIRZKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O4S/c1-16-8-10-19(11-9-16)31(27,28)25-15-18-12-22(29-2)23(30-3)14-21(18)26-20-7-5-4-6-17(20)13-24(25)26/h4-14H,15H2,1-3H3.
What are the key properties of 2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline?
2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline has a molecular weight of 434.52 g/mol, XLogP of 4.67, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxy-6-(4-methylphenyl)sulfonyl-5H-indolo[1,2-a]quinazoline is sourced from PubChem (CID 102221967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).