C21H32O3 — CID 102222049
methyl (4R,7R,8S,11S)-3,3,7,10-tetramethyl-8-(3-methylbut-2-enyl)-2-oxatricyclo[5.3.1.04,11]undec-1(10)-ene-11-carboxylate (PubChem CID 102222049) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is methyl (4R,7R,8S,11S)-3,3,7,10-tetramethyl-8-(3-methylbut-2-enyl)-2-oxatricyclo[5.3.1.04,11]undec-1(10)-ene-11-carboxylate.
| Compound Name | methyl (4R,7R,8S,11S)-3,3,7,10-tetramethyl-8-(3-methylbut-2-enyl)-2-oxatricyclo[5.3.1.04,11]undec-1(10)-ene-11-carboxylate |
|---|---|
| PubChem CID | 102222049 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | methyl (4R,7R,8S,11S)-3,3,7,10-tetramethyl-8-(3-methylbut-2-enyl)-2-oxatricyclo[5.3.1.04,11]undec-1(10)-ene-11-carboxylate |
| SMILES | COC(=O)[C@]12C3=C(C)C[C@H](CC=C(C)C)[C@@]1(C)CC[C@H]2C(C)(C)O3 |
| InChI | InChI=1S/C21H32O3/c1-13(2)8-9-15-12-14(3)17-21(18(22)23-7)16(19(4,5)24-17)10-11-20(15,21)6/h8,15-16H,9-12H2,1-7H3/t15-,16-,20+,21-/m0/s1 |
| InChIKey | SCWKPEAIIBVGIZ-AFMUBRCDSA-N |
| XLogP | 5.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|