C18H30N2+2 — CID 102222158
5,5,12,12-tetramethyl-5,12-diazoniapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene (PubChem CID 102222158) has the molecular formula C18H30N2+2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 5,5,12,12-tetramethyl-5,12-diazoniapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene.
| Compound Name | 5,5,12,12-tetramethyl-5,12-diazoniapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene |
|---|---|
| PubChem CID | 102222158 |
| Molecular Formula | C18H30N2+2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 5,5,12,12-tetramethyl-5,12-diazoniapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene |
| SMILES | C[N+]1(C)CC2C3C=CC(C2C1)C1C2C[N+](C)(C)CC2C31 |
| InChI | InChI=1S/C18H30N2/c1-19(2)7-13-11-5-6-12(14(13)8-19)18-16-10-20(3,4)9-15(16)17(11)18/h5-6,11-18H,7-10H2,1-4H3/q+2 |
| InChIKey | HKIFRTAWHLMSTR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|