C12H8N6O4S — CID 102222192
N-(3-methyl-4-oxo-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)-3-nitrobenzamide (PubChem CID 102222192) has the molecular formula C12H8N6O4S and a molecular weight of 332.30 g/mol. Its IUPAC name is N-(3-methyl-4-oxo-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)-3-nitrobenzamide.
| Compound Name | N-(3-methyl-4-oxo-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 102222192 |
| Molecular Formula | C12H8N6O4S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | N-(3-methyl-4-oxo-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)-3-nitrobenzamide |
| SMILES | Cc1nnc2sc(NC(=O)c3cccc([N+](=O)[O-])c3)nn2c1=O |
| InChI | InChI=1S/C12H8N6O4S/c1-6-10(20)17-12(15-14-6)23-11(16-17)13-9(19)7-3-2-4-8(5-7)18(21)22/h2-5H,1H3,(H,13,16,19) |
| InChIKey | FZMVDZNBNLEGHS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|