C20H29NO3 — CID 102222298
(1S,4R,6R,8S,13S)-3,13-dimethyl-6-propan-2-yl-8-prop-2-enyl-3-azatricyclo[6.4.1.04,13]tridecane-2,7,9-trione (PubChem CID 102222298) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (1S,4R,6R,8S,13S)-3,13-dimethyl-6-propan-2-yl-8-prop-2-enyl-3-azatricyclo[6.4.1.04,13]tridecane-2,7,9-trione.
| Compound Name | (1S,4R,6R,8S,13S)-3,13-dimethyl-6-propan-2-yl-8-prop-2-enyl-3-azatricyclo[6.4.1.04,13]tridecane-2,7,9-trione |
|---|---|
| PubChem CID | 102222298 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (1S,4R,6R,8S,13S)-3,13-dimethyl-6-propan-2-yl-8-prop-2-enyl-3-azatricyclo[6.4.1.04,13]tridecane-2,7,9-trione |
| SMILES | C=CC[C@]12C(=O)CCC[C@@H]3C(=O)N(C)[C@H](C[C@H](C(C)C)C1=O)[C@@]32C |
| InChI | InChI=1S/C20H29NO3/c1-6-10-20-16(22)9-7-8-14-18(24)21(5)15(19(14,20)4)11-13(12(2)3)17(20)23/h6,12-15H,1,7-11H2,2-5H3/t13-,14-,15-,19-,20+/m1/s1 |
| InChIKey | FQJOUUHUIJZWSO-TUYGXSOUSA-N |
| XLogP | 3.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|